C21H25NO5 — CID 158803043
4-ethyl-7-hydroxy-6-methyl-2-oxo-3-(3-oxo-3-piperidin-1-ylpropyl)chromene-8-carbaldehyde (PubChem CID 158803043) has the molecular formula C21H25NO5 and a molecular weight of 371.43 g/mol. Its IUPAC name is 4-ethyl-7-hydroxy-6-methyl-2-oxo-3-(3-oxo-3-piperidin-1-ylpropyl)chromene-8-carbaldehyde.
| Compound Name | 4-ethyl-7-hydroxy-6-methyl-2-oxo-3-(3-oxo-3-piperidin-1-ylpropyl)chromene-8-carbaldehyde |
|---|---|
| PubChem CID | 158803043 |
| Molecular Formula | C21H25NO5 |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | 4-ethyl-7-hydroxy-6-methyl-2-oxo-3-(3-oxo-3-piperidin-1-ylpropyl)chromene-8-carbaldehyde |
| SMILES | CCc1c(CCC(=O)N2CCCCC2)c(=O)oc2c(C=O)c(O)c(C)cc12 |
| InChI | InChI=1S/C21H25NO5/c1-3-14-15(7-8-18(24)22-9-5-4-6-10-22)21(26)27-20-16(14)11-13(2)19(25)17(20)12-23/h11-12,25H,3-10H2,1-2H3 |
| InChIKey | GWPQQKXVPQWSHP-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|