C28H41NO5 — CID 158803726
(3S,3aR,6R,6aR)-3,6-dimethyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan;2-[(3-methoxy-4-octoxyphenyl)methylidene]-3-oxobutanenitrile (PubChem CID 158803726) has the molecular formula C28H41NO5 and a molecular weight of 471.64 g/mol. Its IUPAC name is (3S,3aR,6R,6aR)-3,6-dimethyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan;2-[(3-methoxy-4-octoxyphenyl)methylidene]-3-oxobutanenitrile.
| Compound Name | (3S,3aR,6R,6aR)-3,6-dimethyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan;2-[(3-methoxy-4-octoxyphenyl)methylidene]-3-oxobutanenitrile |
|---|---|
| PubChem CID | 158803726 |
| Molecular Formula | C28H41NO5 |
| Molecular Weight | 471.64 g/mol |
| Exact Mass | 471.30 |
| IUPAC Name | (3S,3aR,6R,6aR)-3,6-dimethyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan;2-[(3-methoxy-4-octoxyphenyl)methylidene]-3-oxobutanenitrile |
| SMILES | CCCCCCCCOc1ccc(C=C(C#N)C(C)=O)cc1OC.C[C@@H]1CO[C@H]2[C@@H]1OC[C@@H]2C |
| InChI | InChI=1S/C20H27NO3.C8H14O2/c1-4-5-6-7-8-9-12-24-19-11-10-17(14-20(19)23-3)13-18(15-21)16(2)22;1-5-3-9-8-6(2)4-10-7(5)8/h10-11,13-14H,4-9,12H2,1-3H3;5-8H,3-4H2,1-2H3/t;5-,6+,7-,8-/m.1/s1 |
| InChIKey | ITURVBNTAXNLNF-KAVXHDQVSA-N |
| XLogP | 5.99 |
| TPSA | 77.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.64 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|