C14H26O3S — CID 158803817
methane;[4-(2-methylbutan-2-yl)phenyl]methanesulfonic acid (PubChem CID 158803817) has the molecular formula C14H26O3S and a molecular weight of 274.43 g/mol. Its IUPAC name is methane;[4-(2-methylbutan-2-yl)phenyl]methanesulfonic acid.
| Compound Name | methane;[4-(2-methylbutan-2-yl)phenyl]methanesulfonic acid |
|---|---|
| PubChem CID | 158803817 |
| Molecular Formula | C14H26O3S |
| Molecular Weight | 274.43 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | methane;[4-(2-methylbutan-2-yl)phenyl]methanesulfonic acid |
| SMILES | C.C.CCC(C)(C)c1ccc(CS(=O)(=O)O)cc1 |
| InChI | InChI=1S/C12H18O3S.2CH4/c1-4-12(2,3)11-7-5-10(6-8-11)9-16(13,14)15;;/h5-8H,4,9H2,1-3H3,(H,13,14,15);2*1H4 |
| InChIKey | ITUYQRZGWFYYAL-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.43 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|