C28H36F2O7 — CID 158805936
1-(2,2-difluorocyclohexyl)oxy-4-(methoxymethoxy)benzene;2-[4-(methoxymethoxy)phenoxy]cyclohexan-1-one (PubChem CID 158805936) has the molecular formula C28H36F2O7 and a molecular weight of 522.59 g/mol. Its IUPAC name is 1-(2,2-difluorocyclohexyl)oxy-4-(methoxymethoxy)benzene;2-[4-(methoxymethoxy)phenoxy]cyclohexan-1-one.
| Compound Name | 1-(2,2-difluorocyclohexyl)oxy-4-(methoxymethoxy)benzene;2-[4-(methoxymethoxy)phenoxy]cyclohexan-1-one |
|---|---|
| PubChem CID | 158805936 |
| Molecular Formula | C28H36F2O7 |
| Molecular Weight | 522.59 g/mol |
| Exact Mass | 522.24 |
| IUPAC Name | 1-(2,2-difluorocyclohexyl)oxy-4-(methoxymethoxy)benzene;2-[4-(methoxymethoxy)phenoxy]cyclohexan-1-one |
| SMILES | COCOc1ccc(OC2CCCCC2(F)F)cc1.COCOc1ccc(OC2CCCCC2=O)cc1 |
| InChI | InChI=1S/C14H18F2O3.C14H18O4/c1-17-10-18-11-5-7-12(8-6-11)19-13-4-2-3-9-14(13,15)16;1-16-10-17-11-6-8-12(9-7-11)18-14-5-3-2-4-13(14)15/h5-8,13H,2-4,9-10H2,1H3;6-9,14H,2-5,10H2,1H3 |
| InChIKey | IUBQJZXINAHZOV-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.59 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|