C34H42F6O10 — CID 158830995
6-[5-[4-(trifluoromethoxy)phenoxy]-1,3-dioxan-2-yl]hexan-2-one (PubChem CID 158830995) has the molecular formula C34H42F6O10 and a molecular weight of 724.69 g/mol. Its IUPAC name is 6-[5-[4-(trifluoromethoxy)phenoxy]-1,3-dioxan-2-yl]hexan-2-one.
| Compound Name | 6-[5-[4-(trifluoromethoxy)phenoxy]-1,3-dioxan-2-yl]hexan-2-one |
|---|---|
| PubChem CID | 158830995 |
| Molecular Formula | C34H42F6O10 |
| Molecular Weight | 724.69 g/mol |
| Exact Mass | 724.27 |
| IUPAC Name | 6-[5-[4-(trifluoromethoxy)phenoxy]-1,3-dioxan-2-yl]hexan-2-one |
| SMILES | CC(=O)CCCCC1OCC(Oc2ccc(OC(F)(F)F)cc2)CO1.CC(=O)CCCCC1OCC(Oc2ccc(OC(F)(F)F)cc2)CO1 |
| InChI | InChI=1S/2C17H21F3O5/c2*1-12(21)4-2-3-5-16-22-10-15(11-23-16)24-13-6-8-14(9-7-13)25-17(18,19)20/h2*6-9,15-16H,2-5,10-11H2,1H3 |
| InChIKey | IXATXIPYDQXVNO-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 107.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.69 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|