C34H21Cl5I2N6 — CID 158808678
3-chloro-6-[(4-chloro-3-iodopyrrolo[3,2-c]pyridin-1-yl)methyl]quinoline;3-chloro-6-(chloromethyl)quinoline;4-chloro-3-iodo-1H-pyrrolo[3,2-c]pyridine (PubChem CID 158808678) has the molecular formula C34H21Cl5I2N6 and a molecular weight of 944.66 g/mol. Its IUPAC name is 3-chloro-6-[(4-chloro-3-iodopyrrolo[3,2-c]pyridin-1-yl)methyl]quinoline;3-chloro-6-(chloromethyl)quinoline;4-chloro-3-iodo-1H-pyrrolo[3,2-c]pyridine.
| Compound Name | 3-chloro-6-[(4-chloro-3-iodopyrrolo[3,2-c]pyridin-1-yl)methyl]quinoline;3-chloro-6-(chloromethyl)quinoline;4-chloro-3-iodo-1H-pyrrolo[3,2-c]pyridine |
|---|---|
| PubChem CID | 158808678 |
| Molecular Formula | C34H21Cl5I2N6 |
| Molecular Weight | 944.66 g/mol |
| Exact Mass | 941.84 |
| IUPAC Name | 3-chloro-6-[(4-chloro-3-iodopyrrolo[3,2-c]pyridin-1-yl)methyl]quinoline;3-chloro-6-(chloromethyl)quinoline;4-chloro-3-iodo-1H-pyrrolo[3,2-c]pyridine |
| SMILES | ClCc1ccc2ncc(Cl)cc2c1.Clc1cnc2ccc(Cn3cc(I)c4c(Cl)nccc43)cc2c1.Clc1nccc2[nH]cc(I)c12 |
| InChI | InChI=1S/C17H10Cl2IN3.C10H7Cl2N.C7H4ClIN2/c18-12-6-11-5-10(1-2-14(11)22-7-12)8-23-9-13(20)16-15(23)3-4-21-17(16)19;11-5-7-1-2-10-8(3-7)4-9(12)6-13-10;8-7-6-4(9)3-11-5(6)1-2-10-7/h1-7,9H,8H2;1-4,6H,5H2;1-3,11H |
| InChIKey | IUKBXRVETGUJNI-UHFFFAOYSA-N |
| XLogP | 11.99 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 944.66 |
| LogP ≤ 5 | 11.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|