C9H15N3O4S — CID 158809422
(2S)-2-amino-4-methylsulfanylbutanoic acid;1H-pyrimidine-2,4-dione (PubChem CID 158809422) has the molecular formula C9H15N3O4S and a molecular weight of 261.30 g/mol. Its IUPAC name is (2S)-2-amino-4-methylsulfanylbutanoic acid;1H-pyrimidine-2,4-dione.
| Compound Name | (2S)-2-amino-4-methylsulfanylbutanoic acid;1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 158809422 |
| Molecular Formula | C9H15N3O4S |
| Molecular Weight | 261.30 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | (2S)-2-amino-4-methylsulfanylbutanoic acid;1H-pyrimidine-2,4-dione |
| SMILES | CSCC[C@H](N)C(=O)O.O=c1cc[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C5H11NO2S.C4H4N2O2/c1-9-3-2-4(6)5(7)8;7-3-1-2-5-4(8)6-3/h4H,2-3,6H2,1H3,(H,7,8);1-2H,(H2,5,6,7,8)/t4-;/m0./s1 |
| InChIKey | IUMJBEMYNTUZID-WCCKRBBISA-N |
| XLogP | -0.79 |
| TPSA | 129.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.30 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |