C18H19NO2S — CID 15881007
N-[2-(2,3-dihydro-1-benzofuran-3-ylmethylsulfanyl)phenyl]-N-ethylformamide (PubChem CID 15881007) has the molecular formula C18H19NO2S and a molecular weight of 313.42 g/mol. Its IUPAC name is N-[2-(2,3-dihydro-1-benzofuran-3-ylmethylsulfanyl)phenyl]-N-ethylformamide.
| Compound Name | N-[2-(2,3-dihydro-1-benzofuran-3-ylmethylsulfanyl)phenyl]-N-ethylformamide |
|---|---|
| PubChem CID | 15881007 |
| Molecular Formula | C18H19NO2S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | N-[2-(2,3-dihydro-1-benzofuran-3-ylmethylsulfanyl)phenyl]-N-ethylformamide |
| SMILES | CCN(C=O)c1ccccc1SCC1COc2ccccc21 |
| InChI | InChI=1S/C18H19NO2S/c1-2-19(13-20)16-8-4-6-10-18(16)22-12-14-11-21-17-9-5-3-7-15(14)17/h3-10,13-14H,2,11-12H2,1H3 |
| InChIKey | SSDNPKRZFPCWJQ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|