C68H48N8 — CID 158816777
8-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2-methylquinoline;1-[4-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-3-methylisoquinoline (PubChem CID 158816777) has the molecular formula C68H48N8 and a molecular weight of 977.19 g/mol. Its IUPAC name is 8-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2-methylquinoline;1-[4-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-3-methylisoquinoline.
| Compound Name | 8-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2-methylquinoline;1-[4-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-3-methylisoquinoline |
|---|---|
| PubChem CID | 158816777 |
| Molecular Formula | C68H48N8 |
| Molecular Weight | 977.19 g/mol |
| Exact Mass | 976.40 |
| IUPAC Name | 8-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2-methylquinoline;1-[4-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-3-methylisoquinoline |
| SMILES | Cc1cc2ccccc2c(-c2ccc(-c3cccc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c3)cc2)n1.Cc1ccc2cccc(-c3ccc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)cc3)c2n1 |
| InChI | InChI=1S/C37H26N4.C31H22N4/c1-25-23-31-15-8-9-18-33(31)34(38-25)27-21-19-26(20-22-27)30-16-10-17-32(24-30)37-40-35(28-11-4-2-5-12-28)39-36(41-37)29-13-6-3-7-14-29;1-21-15-16-23-13-8-14-27(28(23)32-21)22-17-19-26(20-18-22)31-34-29(24-9-4-2-5-10-24)33-30(35-31)25-11-6-3-7-12-25/h2-24H,1H3;2-20H,1H3 |
| InChIKey | IVJGHJHXKQBAFG-UHFFFAOYSA-N |
| XLogP | 16.46 |
| TPSA | 103.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 977.19 |
| LogP ≤ 5 | 16.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |