C63H96N2O4Si2 — CID 158817504
(Z)-12-[tert-butyl(diphenyl)silyl]oxydodec-5-en-1-amine;N-[(Z)-12-[tert-butyl(diphenyl)silyl]oxydodec-5-enyl]-2-oxoheptanamide (PubChem CID 158817504) has the molecular formula C63H96N2O4Si2 and a molecular weight of 1001.64 g/mol. Its IUPAC name is (Z)-12-[tert-butyl(diphenyl)silyl]oxydodec-5-en-1-amine;N-[(Z)-12-[tert-butyl(diphenyl)silyl]oxydodec-5-enyl]-2-oxoheptanamide.
| Compound Name | (Z)-12-[tert-butyl(diphenyl)silyl]oxydodec-5-en-1-amine;N-[(Z)-12-[tert-butyl(diphenyl)silyl]oxydodec-5-enyl]-2-oxoheptanamide |
|---|---|
| PubChem CID | 158817504 |
| Molecular Formula | C63H96N2O4Si2 |
| Molecular Weight | 1001.64 g/mol |
| Exact Mass | 1000.69 |
| IUPAC Name | (Z)-12-[tert-butyl(diphenyl)silyl]oxydodec-5-en-1-amine;N-[(Z)-12-[tert-butyl(diphenyl)silyl]oxydodec-5-enyl]-2-oxoheptanamide |
| SMILES | CC(C)(C)[Si](OCCCCCC/C=C\CCCCN)(c1ccccc1)c1ccccc1.CCCCCC(=O)C(=O)NCCCC/C=C\CCCCCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C35H53NO3Si.C28H43NOSi/c1-5-6-17-28-33(37)34(38)36-29-22-13-11-9-7-8-10-12-14-23-30-39-40(35(2,3)4,31-24-18-15-19-25-31)32-26-20-16-21-27-32;1-28(2,3)31(26-20-14-12-15-21-26,27-22-16-13-17-23-27)30-25-19-11-9-7-5-4-6-8-10-18-24-29/h7,9,15-16,18-21,24-27H,5-6,8,10-14,17,22-23,28-30H2,1-4H3,(H,36,38);4,6,12-17,20-23H,5,7-11,18-19,24-25,29H2,1-3H3/b9-7-;6-4- |
| InChIKey | IVLIURHQILIODB-HQDLSDIASA-N |
| XLogP | 13.70 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1001.64 |
| LogP ≤ 5 | 13.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|