C27H38N4O4 — CID 158818529
[(4R,4aR,7aR,12bS)-9-methoxy-3,4a-dimethyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] 5-(diaminomethylideneamino)-2-ethylpentanoate (PubChem CID 158818529) has the molecular formula C27H38N4O4 and a molecular weight of 482.63 g/mol. Its IUPAC name is [(4R,4aR,7aR,12bS)-9-methoxy-3,4a-dimethyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] 5-(diaminomethylideneamino)-2-ethylpentanoate.
| Compound Name | [(4R,4aR,7aR,12bS)-9-methoxy-3,4a-dimethyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] 5-(diaminomethylideneamino)-2-ethylpentanoate |
|---|---|
| PubChem CID | 158818529 |
| Molecular Formula | C27H38N4O4 |
| Molecular Weight | 482.63 g/mol |
| Exact Mass | 482.29 |
| IUPAC Name | [(4R,4aR,7aR,12bS)-9-methoxy-3,4a-dimethyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] 5-(diaminomethylideneamino)-2-ethylpentanoate |
| SMILES | CCC(CCCN=C(N)N)C(=O)OC1=CC[C@@]2(C)[C@H]3Cc4ccc(OC)c5c4[C@@]2(CCN3C)[C@H]1O5 |
| InChI | InChI=1S/C27H38N4O4/c1-5-16(7-6-13-30-25(28)29)24(32)34-19-10-11-26(2)20-15-17-8-9-18(33-4)22-21(17)27(26,23(19)35-22)12-14-31(20)3/h8-10,16,20,23H,5-7,11-15H2,1-4H3,(H4,28,29,30)/t16?,20-,23+,26+,27+/m1/s1 |
| InChIKey | PBWHKORTWWFHNN-CNKCLCFGSA-N |
| XLogP | 2.87 |
| TPSA | 112.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.63 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|