About 3,3-dimethyloxane-2,6-dione;ethanol
3,3-dimethyloxane-2,6-dione;ethanol (PubChem CID 158820493) has the molecular formula C9H16O4
and a molecular weight of 188.22 g/mol. Its IUPAC name is 3,3-dimethyloxane-2,6-dione;ethanol.
Molecular Properties
| Compound Name | 3,3-dimethyloxane-2,6-dione;ethanol |
| PubChem CID | 158820493 |
| Molecular Formula | C9H16O4 |
| Molecular Weight | 188.22 g/mol |
| Exact Mass | 188.10 |
| IUPAC Name | 3,3-dimethyloxane-2,6-dione;ethanol |
| SMILES | CC1(C)CCC(=O)OC1=O.CCO |
| InChI | InChI=1S/C7H10O3.C2H6O/c1-7(2)4-3-5(8)10-6(7)9;1-2-3/h3-4H2,1-2H3;3H,2H2,1H3 |
| InChIKey | IVUQHJAIZMEXOC-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.22 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3,3-dimethyloxane-2,6-dione;ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dimethyloxane-2,6-dione;ethanol?
The IUPAC name of 3,3-dimethyloxane-2,6-dione;ethanol (CID 158820493) is 3,3-dimethyloxane-2,6-dione;ethanol.
What is the SMILES notation for 3,3-dimethyloxane-2,6-dione;ethanol?
The canonical SMILES for 3,3-dimethyloxane-2,6-dione;ethanol is CC1(C)CCC(=O)OC1=O.CCO.
What is the InChIKey of 3,3-dimethyloxane-2,6-dione;ethanol?
The InChIKey is IVUQHJAIZMEXOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O3.C2H6O/c1-7(2)4-3-5(8)10-6(7)9;1-2-3/h3-4H2,1-2H3;3H,2H2,1H3.
What are the key properties of 3,3-dimethyloxane-2,6-dione;ethanol?
3,3-dimethyloxane-2,6-dione;ethanol has a molecular weight of 188.22 g/mol, XLogP of 0.87, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethyloxane-2,6-dione;ethanol is sourced from PubChem (CID 158820493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).