C15H25N — CID 158824409
1-methyl-7-propyl-3,5,6,7,8,9,10,10a-octahydrocycloocta[c]pyridine (PubChem CID 158824409) has the molecular formula C15H25N and a molecular weight of 219.37 g/mol. Its IUPAC name is 1-methyl-7-propyl-3,5,6,7,8,9,10,10a-octahydrocycloocta[c]pyridine.
| Compound Name | 1-methyl-7-propyl-3,5,6,7,8,9,10,10a-octahydrocycloocta[c]pyridine |
|---|---|
| PubChem CID | 158824409 |
| Molecular Formula | C15H25N |
| Molecular Weight | 219.37 g/mol |
| Exact Mass | 219.20 |
| IUPAC Name | 1-methyl-7-propyl-3,5,6,7,8,9,10,10a-octahydrocycloocta[c]pyridine |
| SMILES | CCCC1CCCC2C(=CCN=C2C)CC1 |
| InChI | InChI=1S/C15H25N/c1-3-5-13-6-4-7-15-12(2)16-11-10-14(15)9-8-13/h10,13,15H,3-9,11H2,1-2H3 |
| InChIKey | IWGVYAWFHYNUAV-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.37 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|