C18H24O5 — CID 15882850
ethyl (2Z)-2-[(5R)-5-[(1S)-1-hydroxy-2-phenylmethoxyethyl]oxolan-2-ylidene]propanoate (PubChem CID 15882850) has the molecular formula C18H24O5 and a molecular weight of 320.38 g/mol. Its IUPAC name is ethyl (2Z)-2-[(5R)-5-[(1S)-1-hydroxy-2-phenylmethoxyethyl]oxolan-2-ylidene]propanoate.
| Compound Name | ethyl (2Z)-2-[(5R)-5-[(1S)-1-hydroxy-2-phenylmethoxyethyl]oxolan-2-ylidene]propanoate |
|---|---|
| PubChem CID | 15882850 |
| Molecular Formula | C18H24O5 |
| Molecular Weight | 320.38 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | ethyl (2Z)-2-[(5R)-5-[(1S)-1-hydroxy-2-phenylmethoxyethyl]oxolan-2-ylidene]propanoate |
| SMILES | CCOC(=O)/C(C)=C1/CC[C@H]([C@@H](O)COCc2ccccc2)O1 |
| InChI | InChI=1S/C18H24O5/c1-3-22-18(20)13(2)16-9-10-17(23-16)15(19)12-21-11-14-7-5-4-6-8-14/h4-8,15,17,19H,3,9-12H2,1-2H3/b16-13-/t15-,17+/m0/s1 |
| InChIKey | WJRMVYDKGOCKHR-QUBPTDRESA-N |
| XLogP | 2.58 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.38 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|