C14H13IN2 — CID 15883001
5-ethylbenzo[c][1,5]naphthyridin-5-ium iodide (PubChem CID 15883001) has the molecular formula C14H13IN2 and a molecular weight of 336.18 g/mol. Its IUPAC name is 5-ethylbenzo[c][1,5]naphthyridin-5-ium iodide.
| Compound Name | 5-ethylbenzo[c][1,5]naphthyridin-5-ium iodide |
|---|---|
| PubChem CID | 15883001 |
| Molecular Formula | C14H13IN2 |
| Molecular Weight | 336.18 g/mol |
| Exact Mass | 336.01 |
| IUPAC Name | 5-ethylbenzo[c][1,5]naphthyridin-5-ium iodide |
| SMILES | CC[n+]1cc2ccccc2c2ncccc21.[I-] |
| InChI | InChI=1S/C14H13N2.HI/c1-2-16-10-11-6-3-4-7-12(11)14-13(16)8-5-9-15-14;/h3-10H,2H2,1H3;1H/q+1;/p-1 |
| InChIKey | OHHGLXAFYDGXQE-UHFFFAOYSA-M |
| XLogP | -0.30 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.18 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|