C22H30O2 — CID 158830141
(4S,5S,8R)-8,12-dimethyl-4-(5-methylhex-4-enyl)-11-methylidene-2-oxatricyclo[7.3.1.05,13]trideca-1(12),9(13)-dien-10-one (PubChem CID 158830141) has the molecular formula C22H30O2 and a molecular weight of 326.48 g/mol. Its IUPAC name is (4S,5S,8R)-8,12-dimethyl-4-(5-methylhex-4-enyl)-11-methylidene-2-oxatricyclo[7.3.1.05,13]trideca-1(12),9(13)-dien-10-one.
| Compound Name | (4S,5S,8R)-8,12-dimethyl-4-(5-methylhex-4-enyl)-11-methylidene-2-oxatricyclo[7.3.1.05,13]trideca-1(12),9(13)-dien-10-one |
|---|---|
| PubChem CID | 158830141 |
| Molecular Formula | C22H30O2 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.22 |
| IUPAC Name | (4S,5S,8R)-8,12-dimethyl-4-(5-methylhex-4-enyl)-11-methylidene-2-oxatricyclo[7.3.1.05,13]trideca-1(12),9(13)-dien-10-one |
| SMILES | C=C1C(=O)C2=C3C(=C1C)OC[C@@H](CCCC=C(C)C)[C@@H]3CC[C@H]2C |
| InChI | InChI=1S/C22H30O2/c1-13(2)8-6-7-9-17-12-24-22-16(5)15(4)21(23)19-14(3)10-11-18(17)20(19)22/h8,14,17-18H,4,6-7,9-12H2,1-3,5H3/t14-,17-,18+/m1/s1 |
| InChIKey | UYDYUDSXYCFPGZ-OLMNPRSZSA-N |
| XLogP | 5.52 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|