About 3-hydroxypropyl 4-[4-(3-hydroxypropoxy)-4-oxobutoxy]butanoate
3-hydroxypropyl 4-[4-(3-hydroxypropoxy)-4-oxobutoxy]butanoate (PubChem CID 158830331) has the molecular formula C14H26O7
and a molecular weight of 306.36 g/mol. Its IUPAC name is 3-hydroxypropyl 4-[4-(3-hydroxypropoxy)-4-oxobutoxy]butanoate.
Molecular Properties
| Compound Name | 3-hydroxypropyl 4-[4-(3-hydroxypropoxy)-4-oxobutoxy]butanoate |
| PubChem CID | 158830331 |
| Molecular Formula | C14H26O7 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | 3-hydroxypropyl 4-[4-(3-hydroxypropoxy)-4-oxobutoxy]butanoate |
| SMILES | O=C(CCCOCCCC(=O)OCCCO)OCCCO |
| InChI | InChI=1S/C14H26O7/c15-7-3-11-20-13(17)5-1-9-19-10-2-6-14(18)21-12-4-8-16/h15-16H,1-12H2 |
| InChIKey | NSZJQTSTUCRNEY-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxypropyl 4-[4-(3-hydroxypropoxy)-4-oxobutoxy]butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxypropyl 4-[4-(3-hydroxypropoxy)-4-oxobutoxy]butanoate?
The IUPAC name of 3-hydroxypropyl 4-[4-(3-hydroxypropoxy)-4-oxobutoxy]butanoate (CID 158830331) is 3-hydroxypropyl 4-[4-(3-hydroxypropoxy)-4-oxobutoxy]butanoate.
What is the SMILES notation for 3-hydroxypropyl 4-[4-(3-hydroxypropoxy)-4-oxobutoxy]butanoate?
The canonical SMILES for 3-hydroxypropyl 4-[4-(3-hydroxypropoxy)-4-oxobutoxy]butanoate is O=C(CCCOCCCC(=O)OCCCO)OCCCO.
What is the InChIKey of 3-hydroxypropyl 4-[4-(3-hydroxypropoxy)-4-oxobutoxy]butanoate?
The InChIKey is NSZJQTSTUCRNEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26O7/c15-7-3-11-20-13(17)5-1-9-19-10-2-6-14(18)21-12-4-8-16/h15-16H,1-12H2.
What are the key properties of 3-hydroxypropyl 4-[4-(3-hydroxypropoxy)-4-oxobutoxy]butanoate?
3-hydroxypropyl 4-[4-(3-hydroxypropoxy)-4-oxobutoxy]butanoate has a molecular weight of 306.36 g/mol, XLogP of 0.41, 14 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxypropyl 4-[4-(3-hydroxypropoxy)-4-oxobutoxy]butanoate is sourced from PubChem (CID 158830331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).