About 3-ethylphthalic acid;propyl 2-hydroxyacetate
3-ethylphthalic acid;propyl 2-hydroxyacetate (PubChem CID 158831271) has the molecular formula C15H20O7
and a molecular weight of 312.32 g/mol. Its IUPAC name is 3-ethylphthalic acid;propyl 2-hydroxyacetate.
Molecular Properties
| Compound Name | 3-ethylphthalic acid;propyl 2-hydroxyacetate |
| PubChem CID | 158831271 |
| Molecular Formula | C15H20O7 |
| Molecular Weight | 312.32 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | 3-ethylphthalic acid;propyl 2-hydroxyacetate |
| SMILES | CCCOC(=O)CO.CCc1cccc(C(=O)O)c1C(=O)O |
| InChI | InChI=1S/C10H10O4.C5H10O3/c1-2-6-4-3-5-7(9(11)12)8(6)10(13)14;1-2-3-8-5(7)4-6/h3-5H,2H2,1H3,(H,11,12)(H,13,14);6H,2-4H2,1H3 |
| InChIKey | IXBNQFPRYLFCCW-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.32 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-ethylphthalic acid;propyl 2-hydroxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethylphthalic acid;propyl 2-hydroxyacetate?
The IUPAC name of 3-ethylphthalic acid;propyl 2-hydroxyacetate (CID 158831271) is 3-ethylphthalic acid;propyl 2-hydroxyacetate.
What is the SMILES notation for 3-ethylphthalic acid;propyl 2-hydroxyacetate?
The canonical SMILES for 3-ethylphthalic acid;propyl 2-hydroxyacetate is CCCOC(=O)CO.CCc1cccc(C(=O)O)c1C(=O)O.
What is the InChIKey of 3-ethylphthalic acid;propyl 2-hydroxyacetate?
The InChIKey is IXBNQFPRYLFCCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O4.C5H10O3/c1-2-6-4-3-5-7(9(11)12)8(6)10(13)14;1-2-3-8-5(7)4-6/h3-5H,2H2,1H3,(H,11,12)(H,13,14);6H,2-4H2,1H3.
What are the key properties of 3-ethylphthalic acid;propyl 2-hydroxyacetate?
3-ethylphthalic acid;propyl 2-hydroxyacetate has a molecular weight of 312.32 g/mol, XLogP of 1.58, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethylphthalic acid;propyl 2-hydroxyacetate is sourced from PubChem (CID 158831271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).