C25H30N2O5 — CID 158831966
N-[[4-(2-hydroxyacetyl)phenyl]methyl]-N-[3-(oxan-4-yl)phenyl]morpholine-4-carboxamide (PubChem CID 158831966) has the molecular formula C25H30N2O5 and a molecular weight of 438.52 g/mol. Its IUPAC name is N-[[4-(2-hydroxyacetyl)phenyl]methyl]-N-[3-(oxan-4-yl)phenyl]morpholine-4-carboxamide.
| Compound Name | N-[[4-(2-hydroxyacetyl)phenyl]methyl]-N-[3-(oxan-4-yl)phenyl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 158831966 |
| Molecular Formula | C25H30N2O5 |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | N-[[4-(2-hydroxyacetyl)phenyl]methyl]-N-[3-(oxan-4-yl)phenyl]morpholine-4-carboxamide |
| SMILES | O=C(CO)c1ccc(CN(C(=O)N2CCOCC2)c2cccc(C3CCOCC3)c2)cc1 |
| InChI | InChI=1S/C25H30N2O5/c28-18-24(29)21-6-4-19(5-7-21)17-27(25(30)26-10-14-32-15-11-26)23-3-1-2-22(16-23)20-8-12-31-13-9-20/h1-7,16,20,28H,8-15,17-18H2 |
| InChIKey | IXDREAUQFGDKKS-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |