C19H20ClN3O4 — CID 146940002
N-(5-chloro-2-pyridinyl)-N-[[4-(2-hydroxyacetyl)phenyl]methyl]morpholine-4-carboxamide (PubChem CID 146940002) has the molecular formula C19H20ClN3O4 and a molecular weight of 389.84 g/mol. Its IUPAC name is N-(5-chloro-2-pyridinyl)-N-[[4-(2-hydroxyacetyl)phenyl]methyl]morpholine-4-carboxamide.
| Compound Name | N-(5-chloro-2-pyridinyl)-N-[[4-(2-hydroxyacetyl)phenyl]methyl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 146940002 |
| Molecular Formula | C19H20ClN3O4 |
| Molecular Weight | 389.84 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | N-(5-chloro-2-pyridinyl)-N-[[4-(2-hydroxyacetyl)phenyl]methyl]morpholine-4-carboxamide |
| SMILES | O=C(CO)c1ccc(CN(C(=O)N2CCOCC2)c2ccc(Cl)cn2)cc1 |
| InChI | InChI=1S/C19H20ClN3O4/c20-16-5-6-18(21-11-16)23(19(26)22-7-9-27-10-8-22)12-14-1-3-15(4-2-14)17(25)13-24/h1-6,11,24H,7-10,12-13H2 |
| InChIKey | AGRMQEULOJGRQJ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 82.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.84 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |