About [cyano-(4-nitrophenyl)methyl] benzoate;3-cyano-2-[(4-nitrophenyl)methyl]benzoic acid
[cyano-(4-nitrophenyl)methyl] benzoate;3-cyano-2-[(4-nitrophenyl)methyl]benzoic acid (PubChem CID 158834342) has the molecular formula C30H20N4O8
and a molecular weight of 564.51 g/mol. Its IUPAC name is [cyano-(4-nitrophenyl)methyl] benzoate;3-cyano-2-[(4-nitrophenyl)methyl]benzoic acid.
Molecular Properties
| Compound Name | [cyano-(4-nitrophenyl)methyl] benzoate;3-cyano-2-[(4-nitrophenyl)methyl]benzoic acid |
| PubChem CID | 158834342 |
| Molecular Formula | C30H20N4O8 |
| Molecular Weight | 564.51 g/mol |
| Exact Mass | 564.13 |
| IUPAC Name | [cyano-(4-nitrophenyl)methyl] benzoate;3-cyano-2-[(4-nitrophenyl)methyl]benzoic acid |
| SMILES | N#CC(OC(=O)c1ccccc1)c1ccc([N+](=O)[O-])cc1.N#Cc1cccc(C(=O)O)c1Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/2C15H10N2O4/c16-9-11-2-1-3-13(15(18)19)14(11)8-10-4-6-12(7-5-10)17(20)21;16-10-14(11-6-8-13(9-7-11)17(19)20)21-15(18)12-4-2-1-3-5-12/h1-7H,8H2,(H,18,19);1-9,14H |
| InChIKey | IXLCXEHKMNMCLT-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 197.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 564.51 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [cyano-(4-nitrophenyl)methyl] benzoate;3-cyano-2-[(4-nitrophenyl)methyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [cyano-(4-nitrophenyl)methyl] benzoate;3-cyano-2-[(4-nitrophenyl)methyl]benzoic acid?
The IUPAC name of [cyano-(4-nitrophenyl)methyl] benzoate;3-cyano-2-[(4-nitrophenyl)methyl]benzoic acid (CID 158834342) is [cyano-(4-nitrophenyl)methyl] benzoate;3-cyano-2-[(4-nitrophenyl)methyl]benzoic acid.
What is the SMILES notation for [cyano-(4-nitrophenyl)methyl] benzoate;3-cyano-2-[(4-nitrophenyl)methyl]benzoic acid?
The canonical SMILES for [cyano-(4-nitrophenyl)methyl] benzoate;3-cyano-2-[(4-nitrophenyl)methyl]benzoic acid is N#CC(OC(=O)c1ccccc1)c1ccc([N+](=O)[O-])cc1.N#Cc1cccc(C(=O)O)c1Cc1ccc([N+](=O)[O-])cc1.
What is the InChIKey of [cyano-(4-nitrophenyl)methyl] benzoate;3-cyano-2-[(4-nitrophenyl)methyl]benzoic acid?
The InChIKey is IXLCXEHKMNMCLT-UHFFFAOYSA-N. The full InChI is InChI=1S/2C15H10N2O4/c16-9-11-2-1-3-13(15(18)19)14(11)8-10-4-6-12(7-5-10)17(20)21;16-10-14(11-6-8-13(9-7-11)17(19)20)21-15(18)12-4-2-1-3-5-12/h1-7H,8H2,(H,18,19);1-9,14H.
What are the key properties of [cyano-(4-nitrophenyl)methyl] benzoate;3-cyano-2-[(4-nitrophenyl)methyl]benzoic acid?
[cyano-(4-nitrophenyl)methyl] benzoate;3-cyano-2-[(4-nitrophenyl)methyl]benzoic acid has a molecular weight of 564.51 g/mol, XLogP of 5.77, 8 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for [cyano-(4-nitrophenyl)methyl] benzoate;3-cyano-2-[(4-nitrophenyl)methyl]benzoic acid is sourced from PubChem (CID 158834342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).