C20H36N2 — CID 158835356
N'-(5-methylhexyl)ethanimidamide;1-methyl-4-(2-methylpropyl)benzene (PubChem CID 158835356) has the molecular formula C20H36N2 and a molecular weight of 304.52 g/mol. Its IUPAC name is N'-(5-methylhexyl)ethanimidamide;1-methyl-4-(2-methylpropyl)benzene.
| Compound Name | N'-(5-methylhexyl)ethanimidamide;1-methyl-4-(2-methylpropyl)benzene |
|---|---|
| PubChem CID | 158835356 |
| Molecular Formula | C20H36N2 |
| Molecular Weight | 304.52 g/mol |
| Exact Mass | 304.29 |
| IUPAC Name | N'-(5-methylhexyl)ethanimidamide;1-methyl-4-(2-methylpropyl)benzene |
| SMILES | C/C(N)=N\CCCCC(C)C.Cc1ccc(CC(C)C)cc1 |
| InChI | InChI=1S/C11H16.C9H20N2/c1-9(2)8-11-6-4-10(3)5-7-11;1-8(2)6-4-5-7-11-9(3)10/h4-7,9H,8H2,1-3H3;8H,4-7H2,1-3H3,(H2,10,11) |
| InChIKey | IXOHNPWVBPBVFD-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.52 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|