C28H54N4 — CID 160531063
2-(5-methylhexyl)guanidine;1-methyl-4-(2-methylpropyl)benzene;7-methyloctan-2-imine (PubChem CID 160531063) has the molecular formula C28H54N4 and a molecular weight of 446.77 g/mol. Its IUPAC name is 2-(5-methylhexyl)guanidine;1-methyl-4-(2-methylpropyl)benzene;7-methyloctan-2-imine.
| Compound Name | 2-(5-methylhexyl)guanidine;1-methyl-4-(2-methylpropyl)benzene;7-methyloctan-2-imine |
|---|---|
| PubChem CID | 160531063 |
| Molecular Formula | C28H54N4 |
| Molecular Weight | 446.77 g/mol |
| Exact Mass | 446.43 |
| IUPAC Name | 2-(5-methylhexyl)guanidine;1-methyl-4-(2-methylpropyl)benzene;7-methyloctan-2-imine |
| SMILES | CC(C)CCCCN=C(N)N.Cc1ccc(CC(C)C)cc1.[H]/N=C(\C)CCCCC(C)C |
| InChI | InChI=1S/C11H16.C9H19N.C8H19N3/c1-9(2)8-11-6-4-10(3)5-7-11;1-8(2)6-4-5-7-9(3)10;1-7(2)5-3-4-6-11-8(9)10/h4-7,9H,8H2,1-3H3;8,10H,4-7H2,1-3H3;7H,3-6H2,1-2H3,(H4,9,10,11)/b;10-9+; |
| InChIKey | QVNQQIMUCCZISK-CTZXAQIWSA-N |
| XLogP | 7.52 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.77 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|