C26H25F3N2O4 — CID 158838912
1-[6-(2,6-difluorophenyl)-5-fluoro-2-pyridinyl]-2-[4-[(2R,4R,5R,6R)-5-ethyl-4,5-dihydroxy-6-methyloxan-2-yl]-3-pyridinyl]ethanone (PubChem CID 158838912) has the molecular formula C26H25F3N2O4 and a molecular weight of 486.49 g/mol. Its IUPAC name is 1-[6-(2,6-difluorophenyl)-5-fluoro-2-pyridinyl]-2-[4-[(2R,4R,5R,6R)-5-ethyl-4,5-dihydroxy-6-methyloxan-2-yl]-3-pyridinyl]ethanone.
| Compound Name | 1-[6-(2,6-difluorophenyl)-5-fluoro-2-pyridinyl]-2-[4-[(2R,4R,5R,6R)-5-ethyl-4,5-dihydroxy-6-methyloxan-2-yl]-3-pyridinyl]ethanone |
|---|---|
| PubChem CID | 158838912 |
| Molecular Formula | C26H25F3N2O4 |
| Molecular Weight | 486.49 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | 1-[6-(2,6-difluorophenyl)-5-fluoro-2-pyridinyl]-2-[4-[(2R,4R,5R,6R)-5-ethyl-4,5-dihydroxy-6-methyloxan-2-yl]-3-pyridinyl]ethanone |
| SMILES | CC[C@@]1(O)[C@H](O)C[C@H](c2ccncc2CC(=O)c2ccc(F)c(-c3c(F)cccc3F)n2)O[C@@H]1C |
| InChI | InChI=1S/C26H25F3N2O4/c1-3-26(34)14(2)35-22(12-23(26)33)16-9-10-30-13-15(16)11-21(32)20-8-7-19(29)25(31-20)24-17(27)5-4-6-18(24)28/h4-10,13-14,22-23,33-34H,3,11-12H2,1-2H3/t14-,22-,23-,26+/m1/s1 |
| InChIKey | IXZHMCIMCLDQEY-NKQHLMFCSA-N |
| XLogP | 4.34 |
| TPSA | 92.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.49 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |