C24H21F3N2O4 — CID 159317481
1-[6-(2,6-difluorophenyl)-5-fluoro-2-pyridinyl]-2-[4-[(2S,4S,5R,6S)-4,5-dihydroxy-6-methyloxan-2-yl]-3-pyridinyl]ethanone (PubChem CID 159317481) has the molecular formula C24H21F3N2O4 and a molecular weight of 458.44 g/mol. Its IUPAC name is 1-[6-(2,6-difluorophenyl)-5-fluoro-2-pyridinyl]-2-[4-[(2S,4S,5R,6S)-4,5-dihydroxy-6-methyloxan-2-yl]-3-pyridinyl]ethanone.
| Compound Name | 1-[6-(2,6-difluorophenyl)-5-fluoro-2-pyridinyl]-2-[4-[(2S,4S,5R,6S)-4,5-dihydroxy-6-methyloxan-2-yl]-3-pyridinyl]ethanone |
|---|---|
| PubChem CID | 159317481 |
| Molecular Formula | C24H21F3N2O4 |
| Molecular Weight | 458.44 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | 1-[6-(2,6-difluorophenyl)-5-fluoro-2-pyridinyl]-2-[4-[(2S,4S,5R,6S)-4,5-dihydroxy-6-methyloxan-2-yl]-3-pyridinyl]ethanone |
| SMILES | C[C@@H]1O[C@H](c2ccncc2CC(=O)c2ccc(F)c(-c3c(F)cccc3F)n2)C[C@H](O)[C@H]1O |
| InChI | InChI=1S/C24H21F3N2O4/c1-12-24(32)20(31)10-21(33-12)14-7-8-28-11-13(14)9-19(30)18-6-5-17(27)23(29-18)22-15(25)3-2-4-16(22)26/h2-8,11-12,20-21,24,31-32H,9-10H2,1H3/t12-,20-,21-,24-/m0/s1 |
| InChIKey | LDIBFLXGVBKHBH-KRGQYULESA-N |
| XLogP | 3.56 |
| TPSA | 92.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.44 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |