C26H24F3N3O3 — CID 162166825
2-[4-[(2R,4R,4aS,7aR)-4-amino-4a-hydroxy-3,4,5,6,7,7a-hexahydro-2H-cyclopenta[b]pyran-2-yl]-3-pyridinyl]-1-[6-(2,6-difluorophenyl)-5-fluoro-2-pyridinyl]ethanone (PubChem CID 162166825) has the molecular formula C26H24F3N3O3 and a molecular weight of 483.49 g/mol. Its IUPAC name is 2-[4-[(2R,4R,4aS,7aR)-4-amino-4a-hydroxy-3,4,5,6,7,7a-hexahydro-2H-cyclopenta[b]pyran-2-yl]-3-pyridinyl]-1-[6-(2,6-difluorophenyl)-5-fluoro-2-pyridinyl]ethanone.
| Compound Name | 2-[4-[(2R,4R,4aS,7aR)-4-amino-4a-hydroxy-3,4,5,6,7,7a-hexahydro-2H-cyclopenta[b]pyran-2-yl]-3-pyridinyl]-1-[6-(2,6-difluorophenyl)-5-fluoro-2-pyridinyl]ethanone |
|---|---|
| PubChem CID | 162166825 |
| Molecular Formula | C26H24F3N3O3 |
| Molecular Weight | 483.49 g/mol |
| Exact Mass | 483.18 |
| IUPAC Name | 2-[4-[(2R,4R,4aS,7aR)-4-amino-4a-hydroxy-3,4,5,6,7,7a-hexahydro-2H-cyclopenta[b]pyran-2-yl]-3-pyridinyl]-1-[6-(2,6-difluorophenyl)-5-fluoro-2-pyridinyl]ethanone |
| SMILES | N[C@@H]1C[C@H](c2ccncc2CC(=O)c2ccc(F)c(-c3c(F)cccc3F)n2)O[C@@H]2CCC[C@]12O |
| InChI | InChI=1S/C26H24F3N3O3/c27-16-3-1-4-17(28)24(16)25-18(29)6-7-19(32-25)20(33)11-14-13-31-10-8-15(14)21-12-22(30)26(34)9-2-5-23(26)35-21/h1,3-4,6-8,10,13,21-23,34H,2,5,9,11-12,30H2/t21-,22-,23-,26+/m1/s1 |
| InChIKey | ZNFZJVQQZSKLSJ-FCBCXNLDSA-N |
| XLogP | 4.06 |
| TPSA | 98.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.49 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |