C25H27N5O3 — CID 158127254
2-[4-[(2R,4R,4aS,7aR)-4-amino-4a-hydroxy-3,4,5,6,7,7a-hexahydro-2H-cyclopenta[b]pyran-2-yl]-3-pyridinyl]-1-(3-amino-6-phenylpyrazin-2-yl)ethanone (PubChem CID 158127254) has the molecular formula C25H27N5O3 and a molecular weight of 445.52 g/mol. Its IUPAC name is 2-[4-[(2R,4R,4aS,7aR)-4-amino-4a-hydroxy-3,4,5,6,7,7a-hexahydro-2H-cyclopenta[b]pyran-2-yl]-3-pyridinyl]-1-(3-amino-6-phenylpyrazin-2-yl)ethanone.
| Compound Name | 2-[4-[(2R,4R,4aS,7aR)-4-amino-4a-hydroxy-3,4,5,6,7,7a-hexahydro-2H-cyclopenta[b]pyran-2-yl]-3-pyridinyl]-1-(3-amino-6-phenylpyrazin-2-yl)ethanone |
|---|---|
| PubChem CID | 158127254 |
| Molecular Formula | C25H27N5O3 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | 2-[4-[(2R,4R,4aS,7aR)-4-amino-4a-hydroxy-3,4,5,6,7,7a-hexahydro-2H-cyclopenta[b]pyran-2-yl]-3-pyridinyl]-1-(3-amino-6-phenylpyrazin-2-yl)ethanone |
| SMILES | Nc1ncc(-c2ccccc2)nc1C(=O)Cc1cnccc1[C@H]1C[C@@H](N)[C@@]2(O)CCC[C@H]2O1 |
| InChI | InChI=1S/C25H27N5O3/c26-21-12-20(33-22-7-4-9-25(21,22)32)17-8-10-28-13-16(17)11-19(31)23-24(27)29-14-18(30-23)15-5-2-1-3-6-15/h1-3,5-6,8,10,13-14,20-22,32H,4,7,9,11-12,26H2,(H2,27,29)/t20-,21-,22-,25+/m1/s1 |
| InChIKey | FSIKSDDVABAEBR-XAISMOLKSA-N |
| XLogP | 2.62 |
| TPSA | 137.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |