C24H25FN4O4 — CID 147092540
1-(3-amino-6-phenylpyrazin-2-yl)-2-[4-[(2S,3R,4S,5S,6R)-3-fluoro-4,5-dihydroxy-5,6-dimethyloxan-2-yl]-3-pyridinyl]ethanone (PubChem CID 147092540) has the molecular formula C24H25FN4O4 and a molecular weight of 452.49 g/mol. Its IUPAC name is 1-(3-amino-6-phenylpyrazin-2-yl)-2-[4-[(2S,3R,4S,5S,6R)-3-fluoro-4,5-dihydroxy-5,6-dimethyloxan-2-yl]-3-pyridinyl]ethanone.
| Compound Name | 1-(3-amino-6-phenylpyrazin-2-yl)-2-[4-[(2S,3R,4S,5S,6R)-3-fluoro-4,5-dihydroxy-5,6-dimethyloxan-2-yl]-3-pyridinyl]ethanone |
|---|---|
| PubChem CID | 147092540 |
| Molecular Formula | C24H25FN4O4 |
| Molecular Weight | 452.49 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | 1-(3-amino-6-phenylpyrazin-2-yl)-2-[4-[(2S,3R,4S,5S,6R)-3-fluoro-4,5-dihydroxy-5,6-dimethyloxan-2-yl]-3-pyridinyl]ethanone |
| SMILES | C[C@H]1O[C@@H](c2ccncc2CC(=O)c2nc(-c3ccccc3)cnc2N)[C@H](F)[C@@H](O)[C@]1(C)O |
| InChI | InChI=1S/C24H25FN4O4/c1-13-24(2,32)22(31)19(25)21(33-13)16-8-9-27-11-15(16)10-18(30)20-23(26)28-12-17(29-20)14-6-4-3-5-7-14/h3-9,11-13,19,21-22,31-32H,10H2,1-2H3,(H2,26,28)/t13-,19+,21+,22-,24-/m1/s1 |
| InChIKey | BJCDMIGPUCJVPT-RQQVCFSVSA-N |
| XLogP | 2.46 |
| TPSA | 131.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.49 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |