C25H25F3N4O3 — CID 161289882
1-[3-amino-6-(3,5,6-trifluoro-2-pyridinyl)-2-pyridinyl]-2-[4-[(1R,3R,4R,5S)-3,4-dihydroxy-4,5-dimethylcyclohexyl]-3-pyridinyl]ethanone (PubChem CID 161289882) has the molecular formula C25H25F3N4O3 and a molecular weight of 486.49 g/mol. Its IUPAC name is 1-[3-amino-6-(3,5,6-trifluoro-2-pyridinyl)-2-pyridinyl]-2-[4-[(1R,3R,4R,5S)-3,4-dihydroxy-4,5-dimethylcyclohexyl]-3-pyridinyl]ethanone.
| Compound Name | 1-[3-amino-6-(3,5,6-trifluoro-2-pyridinyl)-2-pyridinyl]-2-[4-[(1R,3R,4R,5S)-3,4-dihydroxy-4,5-dimethylcyclohexyl]-3-pyridinyl]ethanone |
|---|---|
| PubChem CID | 161289882 |
| Molecular Formula | C25H25F3N4O3 |
| Molecular Weight | 486.49 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | 1-[3-amino-6-(3,5,6-trifluoro-2-pyridinyl)-2-pyridinyl]-2-[4-[(1R,3R,4R,5S)-3,4-dihydroxy-4,5-dimethylcyclohexyl]-3-pyridinyl]ethanone |
| SMILES | C[C@H]1C[C@@H](c2ccncc2CC(=O)c2nc(-c3nc(F)c(F)cc3F)ccc2N)C[C@@H](O)[C@]1(C)O |
| InChI | InChI=1S/C25H25F3N4O3/c1-12-7-13(9-21(34)25(12,2)35)15-5-6-30-11-14(15)8-20(33)23-18(29)3-4-19(31-23)22-16(26)10-17(27)24(28)32-22/h3-6,10-13,21,34-35H,7-9,29H2,1-2H3/t12-,13+,21+,25+/m0/s1 |
| InChIKey | VGFCILGYHAVVHZ-SRKJRMGCSA-N |
| XLogP | 3.59 |
| TPSA | 122.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.49 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|