C29H32F3N3O — CID 161256535
2-[4-[(1R,3R,4S,5S)-3-amino-4,5-dimethylcyclohexyl]-3-pyridinyl]-1-[6-(2,6-difluoro-3,4-dimethylphenyl)-5-fluoro-3-methyl-2-pyridinyl]ethanone (PubChem CID 161256535) has the molecular formula C29H32F3N3O and a molecular weight of 495.59 g/mol. Its IUPAC name is 2-[4-[(1R,3R,4S,5S)-3-amino-4,5-dimethylcyclohexyl]-3-pyridinyl]-1-[6-(2,6-difluoro-3,4-dimethylphenyl)-5-fluoro-3-methyl-2-pyridinyl]ethanone.
| Compound Name | 2-[4-[(1R,3R,4S,5S)-3-amino-4,5-dimethylcyclohexyl]-3-pyridinyl]-1-[6-(2,6-difluoro-3,4-dimethylphenyl)-5-fluoro-3-methyl-2-pyridinyl]ethanone |
|---|---|
| PubChem CID | 161256535 |
| Molecular Formula | C29H32F3N3O |
| Molecular Weight | 495.59 g/mol |
| Exact Mass | 495.25 |
| IUPAC Name | 2-[4-[(1R,3R,4S,5S)-3-amino-4,5-dimethylcyclohexyl]-3-pyridinyl]-1-[6-(2,6-difluoro-3,4-dimethylphenyl)-5-fluoro-3-methyl-2-pyridinyl]ethanone |
| SMILES | Cc1cc(F)c(-c2c(F)cc(C)c(C)c2F)nc1C(=O)Cc1cnccc1[C@H]1C[C@@H](N)[C@@H](C)[C@@H](C)C1 |
| InChI | InChI=1S/C29H32F3N3O/c1-14-8-19(11-24(33)17(14)4)21-6-7-34-13-20(21)12-25(36)28-16(3)10-23(31)29(35-28)26-22(30)9-15(2)18(5)27(26)32/h6-7,9-10,13-14,17,19,24H,8,11-12,33H2,1-5H3/t14-,17-,19+,24+/m0/s1 |
| InChIKey | VBZMKYIVEMVJPL-AEVBCJCYSA-N |
| XLogP | 6.39 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.59 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |