C28H30F3N3O — CID 161382616
2-[4-[(1R,3R,4R,5S)-3-amino-4,5-dimethylcyclohexyl]-3-pyridinyl]-1-[6-(2,6-difluoro-3,4-dimethylphenyl)-5-fluoro-2-pyridinyl]ethanone (PubChem CID 161382616) has the molecular formula C28H30F3N3O and a molecular weight of 481.56 g/mol. Its IUPAC name is 2-[4-[(1R,3R,4R,5S)-3-amino-4,5-dimethylcyclohexyl]-3-pyridinyl]-1-[6-(2,6-difluoro-3,4-dimethylphenyl)-5-fluoro-2-pyridinyl]ethanone.
| Compound Name | 2-[4-[(1R,3R,4R,5S)-3-amino-4,5-dimethylcyclohexyl]-3-pyridinyl]-1-[6-(2,6-difluoro-3,4-dimethylphenyl)-5-fluoro-2-pyridinyl]ethanone |
|---|---|
| PubChem CID | 161382616 |
| Molecular Formula | C28H30F3N3O |
| Molecular Weight | 481.56 g/mol |
| Exact Mass | 481.23 |
| IUPAC Name | 2-[4-[(1R,3R,4R,5S)-3-amino-4,5-dimethylcyclohexyl]-3-pyridinyl]-1-[6-(2,6-difluoro-3,4-dimethylphenyl)-5-fluoro-2-pyridinyl]ethanone |
| SMILES | Cc1cc(F)c(-c2nc(C(=O)Cc3cnccc3[C@H]3C[C@@H](N)[C@H](C)[C@@H](C)C3)ccc2F)c(F)c1C |
| InChI | InChI=1S/C28H30F3N3O/c1-14-9-18(11-23(32)16(14)3)20-7-8-33-13-19(20)12-25(35)24-6-5-21(29)28(34-24)26-22(30)10-15(2)17(4)27(26)31/h5-8,10,13-14,16,18,23H,9,11-12,32H2,1-4H3/t14-,16+,18+,23+/m0/s1 |
| InChIKey | VRXLXUCETMIGGW-WYRWIFRYSA-N |
| XLogP | 6.08 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.56 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |