C27H29FN4O4 — CID 157419652
1-[6-(6-acetyl-3-fluoro-2-pyridinyl)-3-amino-2-pyridinyl]-2-[4-[(1R,3R,4R,5S)-3,4-dihydroxy-4,5-dimethylcyclohexyl]-3-pyridinyl]ethanone (PubChem CID 157419652) has the molecular formula C27H29FN4O4 and a molecular weight of 492.55 g/mol. Its IUPAC name is 1-[6-(6-acetyl-3-fluoro-2-pyridinyl)-3-amino-2-pyridinyl]-2-[4-[(1R,3R,4R,5S)-3,4-dihydroxy-4,5-dimethylcyclohexyl]-3-pyridinyl]ethanone.
| Compound Name | 1-[6-(6-acetyl-3-fluoro-2-pyridinyl)-3-amino-2-pyridinyl]-2-[4-[(1R,3R,4R,5S)-3,4-dihydroxy-4,5-dimethylcyclohexyl]-3-pyridinyl]ethanone |
|---|---|
| PubChem CID | 157419652 |
| Molecular Formula | C27H29FN4O4 |
| Molecular Weight | 492.55 g/mol |
| Exact Mass | 492.22 |
| IUPAC Name | 1-[6-(6-acetyl-3-fluoro-2-pyridinyl)-3-amino-2-pyridinyl]-2-[4-[(1R,3R,4R,5S)-3,4-dihydroxy-4,5-dimethylcyclohexyl]-3-pyridinyl]ethanone |
| SMILES | CC(=O)c1ccc(F)c(-c2ccc(N)c(C(=O)Cc3cnccc3[C@H]3C[C@@H](O)[C@](C)(O)[C@@H](C)C3)n2)n1 |
| InChI | InChI=1S/C27H29FN4O4/c1-14-10-16(12-24(35)27(14,3)36)18-8-9-30-13-17(18)11-23(34)26-20(29)5-7-22(32-26)25-19(28)4-6-21(31-25)15(2)33/h4-9,13-14,16,24,35-36H,10-12,29H2,1-3H3/t14-,16+,24+,27+/m0/s1 |
| InChIKey | BPGIECXZANGTQV-VDLIVYDPSA-N |
| XLogP | 3.51 |
| TPSA | 139.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.55 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |