C17H34N2O4 — CID 158839226
tert-butyl 2-(hydroxymethyl)piperidine-1-carboxylate;piperidin-2-ylmethanol (PubChem CID 158839226) has the molecular formula C17H34N2O4 and a molecular weight of 330.47 g/mol. Its IUPAC name is tert-butyl 2-(hydroxymethyl)piperidine-1-carboxylate;piperidin-2-ylmethanol.
| Compound Name | tert-butyl 2-(hydroxymethyl)piperidine-1-carboxylate;piperidin-2-ylmethanol |
|---|---|
| PubChem CID | 158839226 |
| Molecular Formula | C17H34N2O4 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.25 |
| IUPAC Name | tert-butyl 2-(hydroxymethyl)piperidine-1-carboxylate;piperidin-2-ylmethanol |
| SMILES | CC(C)(C)OC(=O)N1CCCCC1CO.OCC1CCCCN1 |
| InChI | InChI=1S/C11H21NO3.C6H13NO/c1-11(2,3)15-10(14)12-7-5-4-6-9(12)8-13;8-5-6-3-1-2-4-7-6/h9,13H,4-8H2,1-3H3;6-8H,1-5H2 |
| InChIKey | IYAHRDCLWITCBA-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |