About methane;methyl 4-carbonochloridoylbenzoate;2-phenoxyaniline
methane;methyl 4-carbonochloridoylbenzoate;2-phenoxyaniline (PubChem CID 158839752) has the molecular formula C22H22ClNO4
and a molecular weight of 399.87 g/mol. Its IUPAC name is methane;methyl 4-carbonochloridoylbenzoate;2-phenoxyaniline.
Molecular Properties
| Compound Name | methane;methyl 4-carbonochloridoylbenzoate;2-phenoxyaniline |
| PubChem CID | 158839752 |
| Molecular Formula | C22H22ClNO4 |
| Molecular Weight | 399.87 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | methane;methyl 4-carbonochloridoylbenzoate;2-phenoxyaniline |
| SMILES | C.COC(=O)c1ccc(C(=O)Cl)cc1.Nc1ccccc1Oc1ccccc1 |
| InChI | InChI=1S/C12H11NO.C9H7ClO3.CH4/c13-11-8-4-5-9-12(11)14-10-6-2-1-3-7-10;1-13-9(12)7-4-2-6(3-5-7)8(10)11;/h1-9H,13H2;2-5H,1H3;1H4 |
| InChIKey | IYBXJMDRIPSJOY-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 399.87 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze methane;methyl 4-carbonochloridoylbenzoate;2-phenoxyaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;methyl 4-carbonochloridoylbenzoate;2-phenoxyaniline?
The IUPAC name of methane;methyl 4-carbonochloridoylbenzoate;2-phenoxyaniline (CID 158839752) is methane;methyl 4-carbonochloridoylbenzoate;2-phenoxyaniline.
What is the SMILES notation for methane;methyl 4-carbonochloridoylbenzoate;2-phenoxyaniline?
The canonical SMILES for methane;methyl 4-carbonochloridoylbenzoate;2-phenoxyaniline is C.COC(=O)c1ccc(C(=O)Cl)cc1.Nc1ccccc1Oc1ccccc1.
What is the InChIKey of methane;methyl 4-carbonochloridoylbenzoate;2-phenoxyaniline?
The InChIKey is IYBXJMDRIPSJOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NO.C9H7ClO3.CH4/c13-11-8-4-5-9-12(11)14-10-6-2-1-3-7-10;1-13-9(12)7-4-2-6(3-5-7)8(10)11;/h1-9H,13H2;2-5H,1H3;1H4.
What are the key properties of methane;methyl 4-carbonochloridoylbenzoate;2-phenoxyaniline?
methane;methyl 4-carbonochloridoylbenzoate;2-phenoxyaniline has a molecular weight of 399.87 g/mol, XLogP of 5.55, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methane;methyl 4-carbonochloridoylbenzoate;2-phenoxyaniline is sourced from PubChem (CID 158839752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).