C12H24N2W — CID 158839995
ethane;6-ethyl-1-methyl-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridine;tungsten(2+) (PubChem CID 158839995) has the molecular formula C12H24N2W and a molecular weight of 380.18 g/mol. Its IUPAC name is ethane;6-ethyl-1-methyl-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridine;tungsten(2+).
| Compound Name | ethane;6-ethyl-1-methyl-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridine;tungsten(2+) |
|---|---|
| PubChem CID | 158839995 |
| Molecular Formula | C12H24N2W |
| Molecular Weight | 380.18 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | ethane;6-ethyl-1-methyl-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridine;tungsten(2+) |
| SMILES | [CH2-]C.[CH2-]CN1CCC2CCN(C)C2C1.[W+2] |
| InChI | InChI=1S/C10H19N2.C2H5.W/c1-3-12-7-5-9-4-6-11(2)10(9)8-12;1-2;/h9-10H,1,3-8H2,2H3;1H2,2H3;/q2*-1;+2 |
| InChIKey | IYCQWTQJDYHXNS-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.18 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|