C23H30N2O5 — CID 158841580
carbon dioxide;(1S,2S,4S,5R,6S,9R,14S)-5-methyl-22,25-dioxa-11,21-diazahexacyclo[12.7.4.01,14.02,11.04,9.015,20]pentacosa-15,17,19-trien-6-ol (PubChem CID 158841580) has the molecular formula C23H30N2O5 and a molecular weight of 414.50 g/mol. Its IUPAC name is carbon dioxide;(1S,2S,4S,5R,6S,9R,14S)-5-methyl-22,25-dioxa-11,21-diazahexacyclo[12.7.4.01,14.02,11.04,9.015,20]pentacosa-15,17,19-trien-6-ol.
| Compound Name | carbon dioxide;(1S,2S,4S,5R,6S,9R,14S)-5-methyl-22,25-dioxa-11,21-diazahexacyclo[12.7.4.01,14.02,11.04,9.015,20]pentacosa-15,17,19-trien-6-ol |
|---|---|
| PubChem CID | 158841580 |
| Molecular Formula | C23H30N2O5 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | carbon dioxide;(1S,2S,4S,5R,6S,9R,14S)-5-methyl-22,25-dioxa-11,21-diazahexacyclo[12.7.4.01,14.02,11.04,9.015,20]pentacosa-15,17,19-trien-6-ol |
| SMILES | C[C@@H]1[C@H]2C[C@@H]3N(CC[C@@]45OCCO[C@@]34Nc3ccccc35)C[C@@H]2CC[C@@H]1O.O=C=O |
| InChI | InChI=1S/C22H30N2O3.CO2/c1-14-16-12-20-22-21(26-10-11-27-22,17-4-2-3-5-18(17)23-22)8-9-24(20)13-15(16)6-7-19(14)25;2-1-3/h2-5,14-16,19-20,23,25H,6-13H2,1H3;/t14-,15+,16-,19+,20+,21+,22+;/m1./s1 |
| InChIKey | IYHSAPHCIBOSHX-ZRKCYNEGSA-N |
| XLogP | 1.97 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |