C21H30N2O3 — CID 101457588
2-[(1R,2S,4R,5R,10R)-5-ethyl-18,21-dioxa-7,17-diazapentacyclo[8.7.4.01,10.02,7.011,16]henicosa-11,13,15-trien-4-yl]ethanol (PubChem CID 101457588) has the molecular formula C21H30N2O3 and a molecular weight of 358.48 g/mol. Its IUPAC name is 2-[(1R,2S,4R,5R,10R)-5-ethyl-18,21-dioxa-7,17-diazapentacyclo[8.7.4.01,10.02,7.011,16]henicosa-11,13,15-trien-4-yl]ethanol.
| Compound Name | 2-[(1R,2S,4R,5R,10R)-5-ethyl-18,21-dioxa-7,17-diazapentacyclo[8.7.4.01,10.02,7.011,16]henicosa-11,13,15-trien-4-yl]ethanol |
|---|---|
| PubChem CID | 101457588 |
| Molecular Formula | C21H30N2O3 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.23 |
| IUPAC Name | 2-[(1R,2S,4R,5R,10R)-5-ethyl-18,21-dioxa-7,17-diazapentacyclo[8.7.4.01,10.02,7.011,16]henicosa-11,13,15-trien-4-yl]ethanol |
| SMILES | CC[C@H]1CN2CC[C@]34OCCO[C@]3(Nc3ccccc34)[C@@H]2C[C@@H]1CCO |
| InChI | InChI=1S/C21H30N2O3/c1-2-15-14-23-9-8-20-17-5-3-4-6-18(17)22-21(20,26-12-11-25-20)19(23)13-16(15)7-10-24/h3-6,15-16,19,22,24H,2,7-14H2,1H3/t15-,16-,19-,20+,21+/m0/s1 |
| InChIKey | XUHHEWIHDZYFKN-WPCMGHOJSA-N |
| XLogP | 2.55 |
| TPSA | 53.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |