C26H35N3O7 — CID 162451182
(1S,2S,4S,5S,10S)-5-ethyl-4-[(E)-4-hydroxy-1-methoxy-3-oxobut-1-en-2-yl]-12-methoxy-18,21-dioxa-7,17-diazapentacyclo[8.7.4.01,10.02,7.011,16]henicosa-11,13,15-triene-15-carboxamide (PubChem CID 162451182) has the molecular formula C26H35N3O7 and a molecular weight of 501.58 g/mol. Its IUPAC name is (1S,2S,4S,5S,10S)-5-ethyl-4-[(E)-4-hydroxy-1-methoxy-3-oxobut-1-en-2-yl]-12-methoxy-18,21-dioxa-7,17-diazapentacyclo[8.7.4.01,10.02,7.011,16]henicosa-11,13,15-triene-15-carboxamide.
| Compound Name | (1S,2S,4S,5S,10S)-5-ethyl-4-[(E)-4-hydroxy-1-methoxy-3-oxobut-1-en-2-yl]-12-methoxy-18,21-dioxa-7,17-diazapentacyclo[8.7.4.01,10.02,7.011,16]henicosa-11,13,15-triene-15-carboxamide |
|---|---|
| PubChem CID | 162451182 |
| Molecular Formula | C26H35N3O7 |
| Molecular Weight | 501.58 g/mol |
| Exact Mass | 501.25 |
| IUPAC Name | (1S,2S,4S,5S,10S)-5-ethyl-4-[(E)-4-hydroxy-1-methoxy-3-oxobut-1-en-2-yl]-12-methoxy-18,21-dioxa-7,17-diazapentacyclo[8.7.4.01,10.02,7.011,16]henicosa-11,13,15-triene-15-carboxamide |
| SMILES | CC[C@@H]1CN2CC[C@@]34OCCO[C@@]3(Nc3c(C(N)=O)ccc(OC)c34)[C@@H]2C[C@@H]1/C(=C\OC)C(=O)CO |
| InChI | InChI=1S/C26H35N3O7/c1-4-15-12-29-8-7-25-22-20(34-3)6-5-16(24(27)32)23(22)28-26(25,36-10-9-35-25)21(29)11-17(15)18(14-33-2)19(31)13-30/h5-6,14-15,17,21,28,30H,4,7-13H2,1-3H3,(H2,27,32)/b18-14+/t15-,17+,21+,25+,26+/m1/s1 |
| InChIKey | PQCAJCFJNSVDEO-TWGPRAGZSA-N |
| XLogP | 1.37 |
| TPSA | 132.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.58 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|