C19H26N2O — CID 162401005
2-[(1R,9R,11R,12R,19R)-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2,4,6-trien-11-yl]ethanol (PubChem CID 162401005) has the molecular formula C19H26N2O and a molecular weight of 298.43 g/mol. Its IUPAC name is 2-[(1R,9R,11R,12R,19R)-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2,4,6-trien-11-yl]ethanol.
| Compound Name | 2-[(1R,9R,11R,12R,19R)-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2,4,6-trien-11-yl]ethanol |
|---|---|
| PubChem CID | 162401005 |
| Molecular Formula | C19H26N2O |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | 2-[(1R,9R,11R,12R,19R)-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2,4,6-trien-11-yl]ethanol |
| SMILES | OCC[C@H]1C[C@H]2Nc3ccccc3[C@]23CCN2CCC[C@H]1[C@@H]23 |
| InChI | InChI=1S/C19H26N2O/c22-11-7-13-12-17-19(15-5-1-2-6-16(15)20-17)8-10-21-9-3-4-14(13)18(19)21/h1-2,5-6,13-14,17-18,20,22H,3-4,7-12H2/t13-,14+,17+,18+,19+/m0/s1 |
| InChIKey | SNCLSDLWYOJFSW-RMIBSVFLSA-N |
| XLogP | 2.61 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |