About methane;[3-methoxy-2-(methoxymethyl)-2-methylpropyl]benzene;yttrium
methane;[3-methoxy-2-(methoxymethyl)-2-methylpropyl]benzene;yttrium (PubChem CID 158842892) has the molecular formula C14H23O2Y-
and a molecular weight of 312.24 g/mol. Its IUPAC name is methane;[3-methoxy-2-(methoxymethyl)-2-methylpropyl]benzene;yttrium.
Molecular Properties
| Compound Name | methane;[3-methoxy-2-(methoxymethyl)-2-methylpropyl]benzene;yttrium |
| PubChem CID | 158842892 |
| Molecular Formula | C14H23O2Y- |
| Molecular Weight | 312.24 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | methane;[3-methoxy-2-(methoxymethyl)-2-methylpropyl]benzene;yttrium |
| SMILES | C.COCC(C)(COC)Cc1cc[c-]cc1.[Y] |
| InChI | InChI=1S/C13H19O2.CH4.Y/c1-13(10-14-2,11-15-3)9-12-7-5-4-6-8-12;;/h5-8H,9-11H2,1-3H3;1H4;/q-1;; |
| InChIKey | PQYZTMIKVRZLBL-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.24 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze methane;[3-methoxy-2-(methoxymethyl)-2-methylpropyl]benzene;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;[3-methoxy-2-(methoxymethyl)-2-methylpropyl]benzene;yttrium?
The IUPAC name of methane;[3-methoxy-2-(methoxymethyl)-2-methylpropyl]benzene;yttrium (CID 158842892) is methane;[3-methoxy-2-(methoxymethyl)-2-methylpropyl]benzene;yttrium.
What is the SMILES notation for methane;[3-methoxy-2-(methoxymethyl)-2-methylpropyl]benzene;yttrium?
The canonical SMILES for methane;[3-methoxy-2-(methoxymethyl)-2-methylpropyl]benzene;yttrium is C.COCC(C)(COC)Cc1cc[c-]cc1.[Y].
What is the InChIKey of methane;[3-methoxy-2-(methoxymethyl)-2-methylpropyl]benzene;yttrium?
The InChIKey is PQYZTMIKVRZLBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19O2.CH4.Y/c1-13(10-14-2,11-15-3)9-12-7-5-4-6-8-12;;/h5-8H,9-11H2,1-3H3;1H4;/q-1;;.
What are the key properties of methane;[3-methoxy-2-(methoxymethyl)-2-methylpropyl]benzene;yttrium?
methane;[3-methoxy-2-(methoxymethyl)-2-methylpropyl]benzene;yttrium has a molecular weight of 312.24 g/mol, XLogP of 2.96, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methane;[3-methoxy-2-(methoxymethyl)-2-methylpropyl]benzene;yttrium is sourced from PubChem (CID 158842892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).