C29H30O2 — CID 158843273
methyl (Z)-5-(4-cyclobutylphenyl)-5-(4-methylphenyl)-4-phenylpent-4-enoate (PubChem CID 158843273) has the molecular formula C29H30O2 and a molecular weight of 410.56 g/mol. Its IUPAC name is methyl (Z)-5-(4-cyclobutylphenyl)-5-(4-methylphenyl)-4-phenylpent-4-enoate.
| Compound Name | methyl (Z)-5-(4-cyclobutylphenyl)-5-(4-methylphenyl)-4-phenylpent-4-enoate |
|---|---|
| PubChem CID | 158843273 |
| Molecular Formula | C29H30O2 |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | methyl (Z)-5-(4-cyclobutylphenyl)-5-(4-methylphenyl)-4-phenylpent-4-enoate |
| SMILES | COC(=O)CC/C(=C(\c1ccc(C)cc1)c1ccc(C2CCC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C29H30O2/c1-21-11-13-25(14-12-21)29(26-17-15-23(16-18-26)22-9-6-10-22)27(19-20-28(30)31-2)24-7-4-3-5-8-24/h3-5,7-8,11-18,22H,6,9-10,19-20H2,1-2H3/b29-27- |
| InChIKey | JDNWAEXBBYQXOL-OHYPFYFLSA-N |
| XLogP | 7.17 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|