C16H25N5O — CID 158844038
4-[[4-(aminomethyl)cyclohexyl]methyl]-2-(cyclopropylamino)pyrimidine-5-carboxamide (PubChem CID 158844038) has the molecular formula C16H25N5O and a molecular weight of 303.41 g/mol. Its IUPAC name is 4-[[4-(aminomethyl)cyclohexyl]methyl]-2-(cyclopropylamino)pyrimidine-5-carboxamide.
| Compound Name | 4-[[4-(aminomethyl)cyclohexyl]methyl]-2-(cyclopropylamino)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 158844038 |
| Molecular Formula | C16H25N5O |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.21 |
| IUPAC Name | 4-[[4-(aminomethyl)cyclohexyl]methyl]-2-(cyclopropylamino)pyrimidine-5-carboxamide |
| SMILES | NCC1CCC(Cc2nc(NC3CC3)ncc2C(N)=O)CC1 |
| InChI | InChI=1S/C16H25N5O/c17-8-11-3-1-10(2-4-11)7-14-13(15(18)22)9-19-16(21-14)20-12-5-6-12/h9-12H,1-8,17H2,(H2,18,22)(H,19,20,21) |
| InChIKey | IYPGLYRLQHCWBK-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 106.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |