C19H21KN4O4 — CID 158847046
potassium;2-methylpropan-2-olate;N-[3-(5-nitro-1H-pyrrolo[2,3-b]pyridin-2-yl)phenyl]acetamide (PubChem CID 158847046) has the molecular formula C19H21KN4O4 and a molecular weight of 408.50 g/mol. Its IUPAC name is potassium;2-methylpropan-2-olate;N-[3-(5-nitro-1H-pyrrolo[2,3-b]pyridin-2-yl)phenyl]acetamide.
| Compound Name | potassium;2-methylpropan-2-olate;N-[3-(5-nitro-1H-pyrrolo[2,3-b]pyridin-2-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 158847046 |
| Molecular Formula | C19H21KN4O4 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | potassium;2-methylpropan-2-olate;N-[3-(5-nitro-1H-pyrrolo[2,3-b]pyridin-2-yl)phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(-c2cc3cc([N+](=O)[O-])cnc3[nH]2)c1.CC(C)(C)[O-].[K+] |
| InChI | InChI=1S/C15H12N4O3.C4H9O.K/c1-9(20)17-12-4-2-3-10(5-12)14-7-11-6-13(19(21)22)8-16-15(11)18-14;1-4(2,3)5;/h2-8H,1H3,(H,16,18)(H,17,20);1-3H3;/q;-1;+1 |
| InChIKey | IYYTVKCQOOPPRI-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 123.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|