C16H12N4O4 — CID 126489395
2-acetyl-N-(3-nitrophenyl)-1H-pyrrolo[2,3-b]pyridine-5-carboxamide (PubChem CID 126489395) has the molecular formula C16H12N4O4 and a molecular weight of 324.30 g/mol. Its IUPAC name is 2-acetyl-N-(3-nitrophenyl)-1H-pyrrolo[2,3-b]pyridine-5-carboxamide.
| Compound Name | 2-acetyl-N-(3-nitrophenyl)-1H-pyrrolo[2,3-b]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 126489395 |
| Molecular Formula | C16H12N4O4 |
| Molecular Weight | 324.30 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | 2-acetyl-N-(3-nitrophenyl)-1H-pyrrolo[2,3-b]pyridine-5-carboxamide |
| SMILES | CC(=O)c1cc2cc(C(=O)Nc3cccc([N+](=O)[O-])c3)cnc2[nH]1 |
| InChI | InChI=1S/C16H12N4O4/c1-9(21)14-6-10-5-11(8-17-15(10)19-14)16(22)18-12-3-2-4-13(7-12)20(23)24/h2-8H,1H3,(H,17,19)(H,18,22) |
| InChIKey | HSERQNJODUFNMI-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 117.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.30 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|