C20H24KN3O5 — CID 69109687
potassium;2-[3-(2-methoxyethoxy)phenyl]-5-nitro-1H-pyrrolo[2,3-b]pyridine;2-methylpropan-2-olate (PubChem CID 69109687) has the molecular formula C20H24KN3O5 and a molecular weight of 425.53 g/mol. Its IUPAC name is potassium;2-[3-(2-methoxyethoxy)phenyl]-5-nitro-1H-pyrrolo[2,3-b]pyridine;2-methylpropan-2-olate.
| Compound Name | potassium;2-[3-(2-methoxyethoxy)phenyl]-5-nitro-1H-pyrrolo[2,3-b]pyridine;2-methylpropan-2-olate |
|---|---|
| PubChem CID | 69109687 |
| Molecular Formula | C20H24KN3O5 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | potassium;2-[3-(2-methoxyethoxy)phenyl]-5-nitro-1H-pyrrolo[2,3-b]pyridine;2-methylpropan-2-olate |
| SMILES | CC(C)(C)[O-].COCCOc1cccc(-c2cc3cc([N+](=O)[O-])cnc3[nH]2)c1.[K+] |
| InChI | InChI=1S/C16H15N3O4.C4H9O.K/c1-22-5-6-23-14-4-2-3-11(8-14)15-9-12-7-13(19(20)21)10-17-16(12)18-15;1-4(2,3)5;/h2-4,7-10H,5-6H2,1H3,(H,17,18);1-3H3;/q;-1;+1 |
| InChIKey | PCNIEVYGQDDHNO-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 113.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|