C20H23N3O4 — CID 11581473
propan-2-yl N-[2-[3-(2-methoxyethoxy)phenyl]-1H-pyrrolo[2,3-b]pyridin-5-yl]carbamate (PubChem CID 11581473) has the molecular formula C20H23N3O4 and a molecular weight of 369.42 g/mol. Its IUPAC name is propan-2-yl N-[2-[3-(2-methoxyethoxy)phenyl]-1H-pyrrolo[2,3-b]pyridin-5-yl]carbamate.
| Compound Name | propan-2-yl N-[2-[3-(2-methoxyethoxy)phenyl]-1H-pyrrolo[2,3-b]pyridin-5-yl]carbamate |
|---|---|
| PubChem CID | 11581473 |
| Molecular Formula | C20H23N3O4 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | propan-2-yl N-[2-[3-(2-methoxyethoxy)phenyl]-1H-pyrrolo[2,3-b]pyridin-5-yl]carbamate |
| SMILES | COCCOc1cccc(-c2cc3cc(NC(=O)OC(C)C)cnc3[nH]2)c1 |
| InChI | InChI=1S/C20H23N3O4/c1-13(2)27-20(24)22-16-9-15-11-18(23-19(15)21-12-16)14-5-4-6-17(10-14)26-8-7-25-3/h4-6,9-13H,7-8H2,1-3H3,(H,21,23)(H,22,24) |
| InChIKey | RIXPNCHZCXAFDN-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 85.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|