C25H22N6OS — CID 158847697
4-(3,6-diazabicyclo[3.2.0]heptan-3-yl)-8-methyl-2-[(5-oxido-1,5-naphthyridin-5-ium-3-yl)sulfanyl]-9H-indeno[2,1-d]pyrimidine (PubChem CID 158847697) has the molecular formula C25H22N6OS and a molecular weight of 454.56 g/mol. Its IUPAC name is 4-(3,6-diazabicyclo[3.2.0]heptan-3-yl)-8-methyl-2-[(5-oxido-1,5-naphthyridin-5-ium-3-yl)sulfanyl]-9H-indeno[2,1-d]pyrimidine.
| Compound Name | 4-(3,6-diazabicyclo[3.2.0]heptan-3-yl)-8-methyl-2-[(5-oxido-1,5-naphthyridin-5-ium-3-yl)sulfanyl]-9H-indeno[2,1-d]pyrimidine |
|---|---|
| PubChem CID | 158847697 |
| Molecular Formula | C25H22N6OS |
| Molecular Weight | 454.56 g/mol |
| Exact Mass | 454.16 |
| IUPAC Name | 4-(3,6-diazabicyclo[3.2.0]heptan-3-yl)-8-methyl-2-[(5-oxido-1,5-naphthyridin-5-ium-3-yl)sulfanyl]-9H-indeno[2,1-d]pyrimidine |
| SMILES | Cc1cccc2c1Cc1nc(Sc3cnc4ccc[n+]([O-])c4c3)nc(N3CC4CNC4C3)c1-2 |
| InChI | InChI=1S/C25H22N6OS/c1-14-4-2-5-17-18(14)9-20-23(17)24(30-12-15-10-26-21(15)13-30)29-25(28-20)33-16-8-22-19(27-11-16)6-3-7-31(22)32/h2-8,11,15,21,26H,9-10,12-13H2,1H3 |
| InChIKey | CYWPNYJCLLPWAQ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 80.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.56 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|