C26H26N6OS — CID 162257316
(3S,4S)-4-methyl-1-[8-methyl-2-[(5-oxido-1,5-naphthyridin-5-ium-3-yl)sulfanyl]-9H-indeno[2,1-d]pyrimidin-4-yl]piperidin-3-amine (PubChem CID 162257316) has the molecular formula C26H26N6OS and a molecular weight of 470.60 g/mol. Its IUPAC name is (3S,4S)-4-methyl-1-[8-methyl-2-[(5-oxido-1,5-naphthyridin-5-ium-3-yl)sulfanyl]-9H-indeno[2,1-d]pyrimidin-4-yl]piperidin-3-amine.
| Compound Name | (3S,4S)-4-methyl-1-[8-methyl-2-[(5-oxido-1,5-naphthyridin-5-ium-3-yl)sulfanyl]-9H-indeno[2,1-d]pyrimidin-4-yl]piperidin-3-amine |
|---|---|
| PubChem CID | 162257316 |
| Molecular Formula | C26H26N6OS |
| Molecular Weight | 470.60 g/mol |
| Exact Mass | 470.19 |
| IUPAC Name | (3S,4S)-4-methyl-1-[8-methyl-2-[(5-oxido-1,5-naphthyridin-5-ium-3-yl)sulfanyl]-9H-indeno[2,1-d]pyrimidin-4-yl]piperidin-3-amine |
| SMILES | Cc1cccc2c1Cc1nc(Sc3cnc4ccc[n+]([O-])c4c3)nc(N3CC[C@H](C)[C@H](N)C3)c1-2 |
| InChI | InChI=1S/C26H26N6OS/c1-15-5-3-6-18-19(15)12-22-24(18)25(31-10-8-16(2)20(27)14-31)30-26(29-22)34-17-11-23-21(28-13-17)7-4-9-32(23)33/h3-7,9,11,13,16,20H,8,10,12,14,27H2,1-2H3/t16-,20+/m0/s1 |
| InChIKey | AKGMIDZVIBZGMZ-OXJNMPFZSA-N |
| XLogP | 3.86 |
| TPSA | 94.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.60 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|