C22H23ClN6O2S — CID 126551219
(3S)-1-[5-chloro-6-ethyl-2-(4-methoxy-1-oxidoquinolin-1-ium-7-yl)sulfanyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl]pyrrolidin-3-amine (PubChem CID 126551219) has the molecular formula C22H23ClN6O2S and a molecular weight of 470.99 g/mol. Its IUPAC name is (3S)-1-[5-chloro-6-ethyl-2-(4-methoxy-1-oxidoquinolin-1-ium-7-yl)sulfanyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl]pyrrolidin-3-amine.
| Compound Name | (3S)-1-[5-chloro-6-ethyl-2-(4-methoxy-1-oxidoquinolin-1-ium-7-yl)sulfanyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl]pyrrolidin-3-amine |
|---|---|
| PubChem CID | 126551219 |
| Molecular Formula | C22H23ClN6O2S |
| Molecular Weight | 470.99 g/mol |
| Exact Mass | 470.13 |
| IUPAC Name | (3S)-1-[5-chloro-6-ethyl-2-(4-methoxy-1-oxidoquinolin-1-ium-7-yl)sulfanyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl]pyrrolidin-3-amine |
| SMILES | CCc1[nH]c2nc(Sc3ccc4c(OC)cc[n+]([O-])c4c3)nc(N3CC[C@H](N)C3)c2c1Cl |
| InChI | InChI=1S/C22H23ClN6O2S/c1-3-15-19(23)18-20(25-15)26-22(27-21(18)28-8-6-12(24)11-28)32-13-4-5-14-16(10-13)29(30)9-7-17(14)31-2/h4-5,7,9-10,12H,3,6,8,11,24H2,1-2H3,(H,25,26,27)/t12-/m0/s1 |
| InChIKey | HWDWHDMBDJCVIU-LBPRGKRZSA-N |
| XLogP | 3.66 |
| TPSA | 107.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.99 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|