C24H26ClN7S — CID 89470317
(3R)-1-[5-chloro-6-ethyl-2-(1,2,3,4-tetrahydrobenzo[b][1,6]naphthyridin-7-ylsulfanyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]pyrrolidin-3-amine (PubChem CID 89470317) has the molecular formula C24H26ClN7S and a molecular weight of 480.04 g/mol. Its IUPAC name is (3R)-1-[5-chloro-6-ethyl-2-(1,2,3,4-tetrahydrobenzo[b][1,6]naphthyridin-7-ylsulfanyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]pyrrolidin-3-amine.
| Compound Name | (3R)-1-[5-chloro-6-ethyl-2-(1,2,3,4-tetrahydrobenzo[b][1,6]naphthyridin-7-ylsulfanyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]pyrrolidin-3-amine |
|---|---|
| PubChem CID | 89470317 |
| Molecular Formula | C24H26ClN7S |
| Molecular Weight | 480.04 g/mol |
| Exact Mass | 479.17 |
| IUPAC Name | (3R)-1-[5-chloro-6-ethyl-2-(1,2,3,4-tetrahydrobenzo[b][1,6]naphthyridin-7-ylsulfanyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]pyrrolidin-3-amine |
| SMILES | CCc1[nH]c2nc(Sc3ccc4cc5c(nc4c3)CCNC5)nc(N3CC[C@@H](N)C3)c2c1Cl |
| InChI | InChI=1S/C24H26ClN7S/c1-2-17-21(25)20-22(29-17)30-24(31-23(20)32-8-6-15(26)12-32)33-16-4-3-13-9-14-11-27-7-5-18(14)28-19(13)10-16/h3-4,9-10,15,27H,2,5-8,11-12,26H2,1H3,(H,29,30,31)/t15-/m1/s1 |
| InChIKey | LQVXQGCTABNGCO-OAHLLOKOSA-N |
| XLogP | 4.06 |
| TPSA | 95.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.04 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |